C16H19ClN2O4 — CID 90605306
1-(5-chloro-2-methoxyphenyl)-3-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]urea (PubChem CID 90605306) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]urea |
|---|---|
| PubChem CID | 90605306 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[3-(furan-2-yl)-2-hydroxy-2-methylpropyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCC(C)(O)Cc1ccco1 |
| InChI | InChI=1S/C16H19ClN2O4/c1-16(21,9-12-4-3-7-23-12)10-18-15(20)19-13-8-11(17)5-6-14(13)22-2/h3-8,21H,9-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | SWIHZEHUCWNCTJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |