C20H20N2O5 — CID 121085165
8-methoxy-N-(2-methoxyethyl)-2-oxo-N-(pyridin-4-ylmethyl)chromene-3-carboxamide (PubChem CID 121085165) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 8-methoxy-N-(2-methoxyethyl)-2-oxo-N-(pyridin-4-ylmethyl)chromene-3-carboxamide.
| Compound Name | 8-methoxy-N-(2-methoxyethyl)-2-oxo-N-(pyridin-4-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 121085165 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 8-methoxy-N-(2-methoxyethyl)-2-oxo-N-(pyridin-4-ylmethyl)chromene-3-carboxamide |
| SMILES | COCCN(Cc1ccncc1)C(=O)c1cc2cccc(OC)c2oc1=O |
| InChI | InChI=1S/C20H20N2O5/c1-25-11-10-22(13-14-6-8-21-9-7-14)19(23)16-12-15-4-3-5-17(26-2)18(15)27-20(16)24/h3-9,12H,10-11,13H2,1-2H3 |
| InChIKey | KLMDCVMPJYAYHN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|