C14H16ClNO4S — CID 121085981
1-(2-chlorophenyl)-N-[2-(furan-2-yl)-2-hydroxypropyl]methanesulfonamide (PubChem CID 121085981) has the molecular formula C14H16ClNO4S and a molecular weight of 329.81 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[2-(furan-2-yl)-2-hydroxypropyl]methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-[2-(furan-2-yl)-2-hydroxypropyl]methanesulfonamide |
|---|---|
| PubChem CID | 121085981 |
| Molecular Formula | C14H16ClNO4S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[2-(furan-2-yl)-2-hydroxypropyl]methanesulfonamide |
| SMILES | CC(O)(CNS(=O)(=O)Cc1ccccc1Cl)c1ccco1 |
| InChI | InChI=1S/C14H16ClNO4S/c1-14(17,13-7-4-8-20-13)10-16-21(18,19)9-11-5-2-3-6-12(11)15/h2-8,16-17H,9-10H2,1H3 |
| InChIKey | VCARYDPIFZHQRY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |