C18H22ClNO3S — CID 90498609
1-(2-chlorophenyl)-N-(2-hydroxy-2-methyl-4-phenylbutyl)methanesulfonamide (PubChem CID 90498609) has the molecular formula C18H22ClNO3S and a molecular weight of 367.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(2-hydroxy-2-methyl-4-phenylbutyl)methanesulfonamide.
| Compound Name | 1-(2-chlorophenyl)-N-(2-hydroxy-2-methyl-4-phenylbutyl)methanesulfonamide |
|---|---|
| PubChem CID | 90498609 |
| Molecular Formula | C18H22ClNO3S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(2-hydroxy-2-methyl-4-phenylbutyl)methanesulfonamide |
| SMILES | CC(O)(CCc1ccccc1)CNS(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H22ClNO3S/c1-18(21,12-11-15-7-3-2-4-8-15)14-20-24(22,23)13-16-9-5-6-10-17(16)19/h2-10,20-21H,11-14H2,1H3 |
| InChIKey | IMELSUJMTNIZEU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |