C14H24N4O4 — CID 121091838
3-methoxy-1-methyl-N-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]pyrazole-4-carboxamide (PubChem CID 121091838) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-methoxy-1-methyl-N-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]pyrazole-4-carboxamide.
| Compound Name | 3-methoxy-1-methyl-N-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121091838 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-methoxy-1-methyl-N-[2-oxo-2-(3-propan-2-yloxypropylamino)ethyl]pyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)NCC(=O)NCCCOC(C)C |
| InChI | InChI=1S/C14H24N4O4/c1-10(2)22-7-5-6-15-12(19)8-16-13(20)11-9-18(3)17-14(11)21-4/h9-10H,5-8H2,1-4H3,(H,15,19)(H,16,20) |
| InChIKey | LZDJGWBFHIDVPF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|