C12H16N6O3S2 — CID 121091965
N-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]-3-methoxy-1-methylpyrazole-4-carboxamide (PubChem CID 121091965) has the molecular formula C12H16N6O3S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]-3-methoxy-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]-3-methoxy-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121091965 |
| Molecular Formula | C12H16N6O3S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]-3-methoxy-1-methylpyrazole-4-carboxamide |
| SMILES | CCSc1nnc(NC(=O)CNC(=O)c2cn(C)nc2OC)s1 |
| InChI | InChI=1S/C12H16N6O3S2/c1-4-22-12-16-15-11(23-12)14-8(19)5-13-9(20)7-6-18(2)17-10(7)21-3/h6H,4-5H2,1-3H3,(H,13,20)(H,14,15,19) |
| InChIKey | JLGXZQFAAWCVQB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|