C22H19FN6O — CID 121107289
3H-benzimidazol-5-yl-[4-[6-(4-fluorophenyl)pyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 121107289) has the molecular formula C22H19FN6O and a molecular weight of 402.43 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[4-[6-(4-fluorophenyl)pyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[4-[6-(4-fluorophenyl)pyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121107289 |
| Molecular Formula | C22H19FN6O |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3H-benzimidazol-5-yl-[4-[6-(4-fluorophenyl)pyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCN(c2cc(-c3ccc(F)cc3)ncn2)CC1 |
| InChI | InChI=1S/C22H19FN6O/c23-17-4-1-15(2-5-17)19-12-21(27-14-25-19)28-7-9-29(10-8-28)22(30)16-3-6-18-20(11-16)26-13-24-18/h1-6,11-14H,7-10H2,(H,24,26) |
| InChIKey | TZNUROHSSGLQPX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |