C18H19ClN4O2S — CID 121108220
3-chloro-N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]benzenesulfonamide (PubChem CID 121108220) has the molecular formula C18H19ClN4O2S and a molecular weight of 390.90 g/mol. Its IUPAC name is 3-chloro-N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121108220 |
| Molecular Formula | C18H19ClN4O2S |
| Molecular Weight | 390.90 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 3-chloro-N-[[1-(3-cyano-2-pyridinyl)piperidin-4-yl]methyl]benzenesulfonamide |
| SMILES | N#Cc1cccnc1N1CCC(CNS(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H19ClN4O2S/c19-16-4-1-5-17(11-16)26(24,25)22-13-14-6-9-23(10-7-14)18-15(12-20)3-2-8-21-18/h1-5,8,11,14,22H,6-7,9-10,13H2 |
| InChIKey | ODWDENHDXUDMSE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.90 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |