C18H24N6O2 — CID 121118653
1-(6-methylpyridazin-3-yl)-N-[3-(6-oxopyridazin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 121118653) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-(6-methylpyridazin-3-yl)-N-[3-(6-oxopyridazin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(6-methylpyridazin-3-yl)-N-[3-(6-oxopyridazin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121118653 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 1-(6-methylpyridazin-3-yl)-N-[3-(6-oxopyridazin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(N2CCCC(C(=O)NCCCn3ncccc3=O)C2)nn1 |
| InChI | InChI=1S/C18H24N6O2/c1-14-7-8-16(22-21-14)23-11-3-5-15(13-23)18(26)19-9-4-12-24-17(25)6-2-10-20-24/h2,6-8,10,15H,3-5,9,11-13H2,1H3,(H,19,26) |
| InChIKey | FQNSYWFAPJLCAQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|