C16H21N3O3S — CID 121137078
N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-4-ethylbenzenesulfonamide (PubChem CID 121137078) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-4-ethylbenzenesulfonamide.
| Compound Name | N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-4-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 121137078 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-4-ethylbenzenesulfonamide |
| SMILES | CCOc1nc(C)c(NS(=O)(=O)c2ccc(CC)cc2)c(C)n1 |
| InChI | InChI=1S/C16H21N3O3S/c1-5-13-7-9-14(10-8-13)23(20,21)19-15-11(3)17-16(22-6-2)18-12(15)4/h7-10,19H,5-6H2,1-4H3 |
| InChIKey | FILKGTGTXPFNDP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |