C15H17N5O7S — CID 122356193
N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-4-methyl-3,5-dinitrobenzenesulfonamide (PubChem CID 122356193) has the molecular formula C15H17N5O7S and a molecular weight of 411.40 g/mol. Its IUPAC name is N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-4-methyl-3,5-dinitrobenzenesulfonamide.
| Compound Name | N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-4-methyl-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122356193 |
| Molecular Formula | C15H17N5O7S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-(2-ethoxy-4,6-dimethylpyrimidin-5-yl)-4-methyl-3,5-dinitrobenzenesulfonamide |
| SMILES | CCOc1nc(C)c(NS(=O)(=O)c2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)c(C)n1 |
| InChI | InChI=1S/C15H17N5O7S/c1-5-27-15-16-9(3)14(10(4)17-15)18-28(25,26)11-6-12(19(21)22)8(2)13(7-11)20(23)24/h6-7,18H,5H2,1-4H3 |
| InChIKey | KWSRNKSNCXRRMW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 167.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|