C13H13N5O8S — CID 122304242
N-(2,4-dimethoxypyrimidin-5-yl)-4-methyl-3,5-dinitrobenzenesulfonamide (PubChem CID 122304242) has the molecular formula C13H13N5O8S and a molecular weight of 399.34 g/mol. Its IUPAC name is N-(2,4-dimethoxypyrimidin-5-yl)-4-methyl-3,5-dinitrobenzenesulfonamide.
| Compound Name | N-(2,4-dimethoxypyrimidin-5-yl)-4-methyl-3,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122304242 |
| Molecular Formula | C13H13N5O8S |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-(2,4-dimethoxypyrimidin-5-yl)-4-methyl-3,5-dinitrobenzenesulfonamide |
| SMILES | COc1ncc(NS(=O)(=O)c2cc([N+](=O)[O-])c(C)c([N+](=O)[O-])c2)c(OC)n1 |
| InChI | InChI=1S/C13H13N5O8S/c1-7-10(17(19)20)4-8(5-11(7)18(21)22)27(23,24)16-9-6-14-13(26-3)15-12(9)25-2/h4-6,16H,1-3H3 |
| InChIKey | ALYBPHJUFUGQDE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 176.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|