C12H12N4O6S — CID 122304240
N-(2,4-dimethoxypyrimidin-5-yl)-3-nitrobenzenesulfonamide (PubChem CID 122304240) has the molecular formula C12H12N4O6S and a molecular weight of 340.32 g/mol. Its IUPAC name is N-(2,4-dimethoxypyrimidin-5-yl)-3-nitrobenzenesulfonamide.
| Compound Name | N-(2,4-dimethoxypyrimidin-5-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122304240 |
| Molecular Formula | C12H12N4O6S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-(2,4-dimethoxypyrimidin-5-yl)-3-nitrobenzenesulfonamide |
| SMILES | COc1ncc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)c(OC)n1 |
| InChI | InChI=1S/C12H12N4O6S/c1-21-11-10(7-13-12(14-11)22-2)15-23(19,20)9-5-3-4-8(6-9)16(17)18/h3-7,15H,1-2H3 |
| InChIKey | JIJIWMQZOYFPQT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|