C21H26N4O4 — CID 121145243
1-(3-methoxyphenyl)-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 121145243) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-methoxyphenyl)-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 121145243 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-(3-methoxyphenyl)-N-[1-(oxan-2-ylmethyl)pyrazol-4-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cccc(N2CC(C(=O)Nc3cnn(CC4CCCCO4)c3)CC2=O)c1 |
| InChI | InChI=1S/C21H26N4O4/c1-28-18-7-4-5-17(10-18)25-12-15(9-20(25)26)21(27)23-16-11-22-24(13-16)14-19-6-2-3-8-29-19/h4-5,7,10-11,13,15,19H,2-3,6,8-9,12,14H2,1H3,(H,23,27) |
| InChIKey | VUOBXCQVTXCQLV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |