C17H19BrF2N4O2 — CID 121151241
3-[5-bromo-2-(difluoromethoxy)phenyl]-1-[4-(triazol-1-yl)piperidin-1-yl]propan-1-one (PubChem CID 121151241) has the molecular formula C17H19BrF2N4O2 and a molecular weight of 429.27 g/mol. Its IUPAC name is 3-[5-bromo-2-(difluoromethoxy)phenyl]-1-[4-(triazol-1-yl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-[5-bromo-2-(difluoromethoxy)phenyl]-1-[4-(triazol-1-yl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 121151241 |
| Molecular Formula | C17H19BrF2N4O2 |
| Molecular Weight | 429.27 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 3-[5-bromo-2-(difluoromethoxy)phenyl]-1-[4-(triazol-1-yl)piperidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1cc(Br)ccc1OC(F)F)N1CCC(n2ccnn2)CC1 |
| InChI | InChI=1S/C17H19BrF2N4O2/c18-13-2-3-15(26-17(19)20)12(11-13)1-4-16(25)23-8-5-14(6-9-23)24-10-7-21-22-24/h2-3,7,10-11,14,17H,1,4-6,8-9H2 |
| InChIKey | LCSNVFYLETXBBE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |