C18H25ClN4O4S — CID 121153894
1-[1-[3-[(3-chlorophenyl)sulfonylamino]propanoyl]azetidin-3-yl]piperidine-4-carboxamide (PubChem CID 121153894) has the molecular formula C18H25ClN4O4S and a molecular weight of 428.94 g/mol. Its IUPAC name is 1-[1-[3-[(3-chlorophenyl)sulfonylamino]propanoyl]azetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[3-[(3-chlorophenyl)sulfonylamino]propanoyl]azetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121153894 |
| Molecular Formula | C18H25ClN4O4S |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-[1-[3-[(3-chlorophenyl)sulfonylamino]propanoyl]azetidin-3-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CN(C(=O)CCNS(=O)(=O)c3cccc(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C18H25ClN4O4S/c19-14-2-1-3-16(10-14)28(26,27)21-7-4-17(24)23-11-15(12-23)22-8-5-13(6-9-22)18(20)25/h1-3,10,13,15,21H,4-9,11-12H2,(H2,20,25) |
| InChIKey | GSHLQJLCYQGPPN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |