C20H28N4O — CID 121154730
(3,5-ditert-butylphenyl)-[3-(triazol-1-yl)azetidin-1-yl]methanone (PubChem CID 121154730) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl)-[3-(triazol-1-yl)azetidin-1-yl]methanone.
| Compound Name | (3,5-ditert-butylphenyl)-[3-(triazol-1-yl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 121154730 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (3,5-ditert-butylphenyl)-[3-(triazol-1-yl)azetidin-1-yl]methanone |
| SMILES | CC(C)(C)c1cc(C(=O)N2CC(n3ccnn3)C2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H28N4O/c1-19(2,3)15-9-14(10-16(11-15)20(4,5)6)18(25)23-12-17(13-23)24-8-7-21-22-24/h7-11,17H,12-13H2,1-6H3 |
| InChIKey | OHFWCIKCPFTODE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |