C23H33NO — CID 121186919
(4-cyclopropylidenepiperidin-1-yl)-(3,5-ditert-butylphenyl)methanone (PubChem CID 121186919) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (4-cyclopropylidenepiperidin-1-yl)-(3,5-ditert-butylphenyl)methanone.
| Compound Name | (4-cyclopropylidenepiperidin-1-yl)-(3,5-ditert-butylphenyl)methanone |
|---|---|
| PubChem CID | 121186919 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (4-cyclopropylidenepiperidin-1-yl)-(3,5-ditert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCC(=C3CC3)CC2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H33NO/c1-22(2,3)19-13-18(14-20(15-19)23(4,5)6)21(25)24-11-9-17(10-12-24)16-7-8-16/h13-15H,7-12H2,1-6H3 |
| InChIKey | ZVIDRGHMAFMPEC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|