C17H17Cl2N3O3 — CID 121161897
2-(2,4-dichlorophenoxy)-1-(4-pyrimidin-4-yloxypiperidin-1-yl)ethanone (PubChem CID 121161897) has the molecular formula C17H17Cl2N3O3 and a molecular weight of 382.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-(4-pyrimidin-4-yloxypiperidin-1-yl)ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-(4-pyrimidin-4-yloxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 121161897 |
| Molecular Formula | C17H17Cl2N3O3 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-(4-pyrimidin-4-yloxypiperidin-1-yl)ethanone |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N1CCC(Oc2ccncn2)CC1 |
| InChI | InChI=1S/C17H17Cl2N3O3/c18-12-1-2-15(14(19)9-12)24-10-17(23)22-7-4-13(5-8-22)25-16-3-6-20-11-21-16/h1-3,6,9,11,13H,4-5,7-8,10H2 |
| InChIKey | WWNOQEBNMKPNGO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |