C18H21N3O4 — CID 121161902
2-(3-methoxyphenoxy)-1-(4-pyrimidin-4-yloxypiperidin-1-yl)ethanone (PubChem CID 121161902) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-1-(4-pyrimidin-4-yloxypiperidin-1-yl)ethanone.
| Compound Name | 2-(3-methoxyphenoxy)-1-(4-pyrimidin-4-yloxypiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 121161902 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(3-methoxyphenoxy)-1-(4-pyrimidin-4-yloxypiperidin-1-yl)ethanone |
| SMILES | COc1cccc(OCC(=O)N2CCC(Oc3ccncn3)CC2)c1 |
| InChI | InChI=1S/C18H21N3O4/c1-23-15-3-2-4-16(11-15)24-12-18(22)21-9-6-14(7-10-21)25-17-5-8-19-13-20-17/h2-5,8,11,13-14H,6-7,9-10,12H2,1H3 |
| InChIKey | NWRSOOFWXWJSNT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |