C16H22N6O3 — CID 121163340
N-(2-methoxyethyl)-4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidine-1-carboxamide (PubChem CID 121163340) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidine-1-carboxamide.
| Compound Name | N-(2-methoxyethyl)-4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 121163340 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-(2-methoxyethyl)-4-(6-pyrazol-1-ylpyridazin-3-yl)oxypiperidine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCC(Oc2ccc(-n3cccn3)nn2)CC1 |
| InChI | InChI=1S/C16H22N6O3/c1-24-12-8-17-16(23)21-10-5-13(6-11-21)25-15-4-3-14(19-20-15)22-9-2-7-18-22/h2-4,7,9,13H,5-6,8,10-12H2,1H3,(H,17,23) |
| InChIKey | UEZHYPZTVQDPIU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|