C13H11N5O2S — CID 121167615
N-(2,1,3-benzothiadiazol-4-yl)-6-ethoxypyrimidine-4-carboxamide (PubChem CID 121167615) has the molecular formula C13H11N5O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-6-ethoxypyrimidine-4-carboxamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-6-ethoxypyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 121167615 |
| Molecular Formula | C13H11N5O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-6-ethoxypyrimidine-4-carboxamide |
| SMILES | CCOc1cc(C(=O)Nc2cccc3nsnc23)ncn1 |
| InChI | InChI=1S/C13H11N5O2S/c1-2-20-11-6-10(14-7-15-11)13(19)16-8-4-3-5-9-12(8)18-21-17-9/h3-7H,2H2,1H3,(H,16,19) |
| InChIKey | CAMOAMXEOLLRLG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |