C19H21N3O3S — CID 2272136
N-(2,1,3-benzothiadiazol-4-yl)-3,5-dipropoxybenzamide (PubChem CID 2272136) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-3,5-dipropoxybenzamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-3,5-dipropoxybenzamide |
|---|---|
| PubChem CID | 2272136 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-3,5-dipropoxybenzamide |
| SMILES | CCCOc1cc(OCCC)cc(C(=O)Nc2cccc3nsnc23)c1 |
| InChI | InChI=1S/C19H21N3O3S/c1-3-8-24-14-10-13(11-15(12-14)25-9-4-2)19(23)20-16-6-5-7-17-18(16)22-26-21-17/h5-7,10-12H,3-4,8-9H2,1-2H3,(H,20,23) |
| InChIKey | FCFGAVSUZKBBEY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |