C11H11N5O4 — CID 121167679
N-(2,4-dioxo-1H-pyrimidin-5-yl)-6-ethoxypyrimidine-4-carboxamide (PubChem CID 121167679) has the molecular formula C11H11N5O4 and a molecular weight of 277.24 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-5-yl)-6-ethoxypyrimidine-4-carboxamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-6-ethoxypyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 121167679 |
| Molecular Formula | C11H11N5O4 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-5-yl)-6-ethoxypyrimidine-4-carboxamide |
| SMILES | CCOc1cc(C(=O)Nc2c[nH]c(=O)[nH]c2=O)ncn1 |
| InChI | InChI=1S/C11H11N5O4/c1-2-20-8-3-6(13-5-14-8)9(17)15-7-4-12-11(19)16-10(7)18/h3-5H,2H2,1H3,(H,15,17)(H2,12,16,18,19) |
| InChIKey | BMZPJUBQZPUVLM-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |