C16H20ClFN4O — CID 121176717
3-(2-chloro-6-fluorophenyl)-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]propanamide (PubChem CID 121176717) has the molecular formula C16H20ClFN4O and a molecular weight of 338.81 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]propanamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]propanamide |
|---|---|
| PubChem CID | 121176717 |
| Molecular Formula | C16H20ClFN4O |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-[3-methyl-1-(triazol-2-yl)butan-2-yl]propanamide |
| SMILES | CC(C)C(Cn1nccn1)NC(=O)CCc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H20ClFN4O/c1-11(2)15(10-22-19-8-9-20-22)21-16(23)7-6-12-13(17)4-3-5-14(12)18/h3-5,8-9,11,15H,6-7,10H2,1-2H3,(H,21,23) |
| InChIKey | FEBUIWFPHMWOHL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |