About 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole
1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole (PubChem CID 121183845) has the molecular formula C15H18N4O
and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole.
Molecular Properties
| Compound Name | 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole |
| PubChem CID | 121183845 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole |
| SMILES | c1ccc2c(c1)CCOC2CN1CC(n2ccnn2)C1 |
| InChI | InChI=1S/C15H18N4O/c1-2-4-14-12(3-1)5-8-20-15(14)11-18-9-13(10-18)19-7-6-16-17-19/h1-4,6-7,13,15H,5,8-11H2 |
| InChIKey | SJQMOOLPEQUXCD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole?
The IUPAC name of 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole (CID 121183845) is 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole.
What is the SMILES notation for 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole?
The canonical SMILES for 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole is c1ccc2c(c1)CCOC2CN1CC(n2ccnn2)C1.
What is the InChIKey of 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole?
The InChIKey is SJQMOOLPEQUXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O/c1-2-4-14-12(3-1)5-8-20-15(14)11-18-9-13(10-18)19-7-6-16-17-19/h1-4,6-7,13,15H,5,8-11H2.
What are the key properties of 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole?
1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole has a molecular weight of 270.34 g/mol, XLogP of 1.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,4-dihydro-1H-isochromen-1-ylmethyl)azetidin-3-yl]triazole is sourced from PubChem (CID 121183845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).