C18H19ClN2O3 — CID 121187849
3-[1-[3-(4-chloro-3-methylphenyl)propanoyl]azetidin-3-yl]-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 121187849) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 3-[1-[3-(4-chloro-3-methylphenyl)propanoyl]azetidin-3-yl]-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-[1-[3-(4-chloro-3-methylphenyl)propanoyl]azetidin-3-yl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 121187849 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 3-[1-[3-(4-chloro-3-methylphenyl)propanoyl]azetidin-3-yl]-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | Cc1cc(CCC(=O)N2CC(N3C(=O)C4CC4C3=O)C2)ccc1Cl |
| InChI | InChI=1S/C18H19ClN2O3/c1-10-6-11(2-4-15(10)19)3-5-16(22)20-8-12(9-20)21-17(23)13-7-14(13)18(21)24/h2,4,6,12-14H,3,5,7-9H2,1H3 |
| InChIKey | SUFXRCGIDWNNKT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|