C11H16N2O2S — CID 121191202
6-butylsulfonyl-5,7-dihydropyrrolo[3,4-b]pyridine (PubChem CID 121191202) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 6-butylsulfonyl-5,7-dihydropyrrolo[3,4-b]pyridine.
| Compound Name | 6-butylsulfonyl-5,7-dihydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 121191202 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 6-butylsulfonyl-5,7-dihydropyrrolo[3,4-b]pyridine |
| SMILES | CCCCS(=O)(=O)N1Cc2cccnc2C1 |
| InChI | InChI=1S/C11H16N2O2S/c1-2-3-7-16(14,15)13-8-10-5-4-6-12-11(10)9-13/h4-6H,2-3,7-9H2,1H3 |
| InChIKey | JKFZEOPPNPOKFQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |