About 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione
6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 113082634) has the molecular formula C16H21N3O4S
and a molecular weight of 351.43 g/mol. Its IUPAC name is 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione.
Molecular Properties
| Compound Name | 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione |
| PubChem CID | 113082634 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | CCCCS(=O)(=O)N1CCC(N2C(=O)c3cccnc3C2=O)CC1 |
| InChI | InChI=1S/C16H21N3O4S/c1-2-3-11-24(22,23)18-9-6-12(7-10-18)19-15(20)13-5-4-8-17-14(13)16(19)21/h4-5,8,12H,2-3,6-7,9-11H2,1H3 |
| InChIKey | VAHAKEVMKSOMAG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione?
The IUPAC name of 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione (CID 113082634) is 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione.
What is the SMILES notation for 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione?
The canonical SMILES for 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione is CCCCS(=O)(=O)N1CCC(N2C(=O)c3cccnc3C2=O)CC1.
What is the InChIKey of 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione?
The InChIKey is VAHAKEVMKSOMAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O4S/c1-2-3-11-24(22,23)18-9-6-12(7-10-18)19-15(20)13-5-4-8-17-14(13)16(19)21/h4-5,8,12H,2-3,6-7,9-11H2,1H3.
What are the key properties of 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione?
6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione has a molecular weight of 351.43 g/mol, XLogP of 1.27, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-butylsulfonylpiperidin-4-yl)pyrrolo[3,4-b]pyridine-5,7-dione is sourced from PubChem (CID 113082634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).