C17H14FN3O4S — CID 113082722
6-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 113082722) has the molecular formula C17H14FN3O4S and a molecular weight of 375.38 g/mol. Its IUPAC name is 6-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 113082722 |
| Molecular Formula | C17H14FN3O4S |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 6-[1-(4-fluorophenyl)sulfonylpyrrolidin-3-yl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1C1CCN(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H14FN3O4S/c18-11-3-5-13(6-4-11)26(24,25)20-9-7-12(10-20)21-16(22)14-2-1-8-19-15(14)17(21)23/h1-6,8,12H,7,9-10H2 |
| InChIKey | ZJEDFJVFQDLAFD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|