C19H19NO4S3 — CID 121191730
4-naphthalen-1-ylsulfonyl-7-thiophen-2-yl-1,4-thiazepane 1,1-dioxide (PubChem CID 121191730) has the molecular formula C19H19NO4S3 and a molecular weight of 421.57 g/mol. Its IUPAC name is 4-naphthalen-1-ylsulfonyl-7-thiophen-2-yl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 4-naphthalen-1-ylsulfonyl-7-thiophen-2-yl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 121191730 |
| Molecular Formula | C19H19NO4S3 |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | 4-naphthalen-1-ylsulfonyl-7-thiophen-2-yl-1,4-thiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(S(=O)(=O)c2cccc3ccccc23)CCC1c1cccs1 |
| InChI | InChI=1S/C19H19NO4S3/c21-26(22)14-12-20(11-10-19(26)17-8-4-13-25-17)27(23,24)18-9-3-6-15-5-1-2-7-16(15)18/h1-9,13,19H,10-12,14H2 |
| InChIKey | IOTBNNLURCUWOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |