C15H19N5O3 — CID 121196023
oxan-2-ylmethyl N-[(1-pyridin-4-yltriazol-4-yl)methyl]carbamate (PubChem CID 121196023) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is oxan-2-ylmethyl N-[(1-pyridin-4-yltriazol-4-yl)methyl]carbamate.
| Compound Name | oxan-2-ylmethyl N-[(1-pyridin-4-yltriazol-4-yl)methyl]carbamate |
|---|---|
| PubChem CID | 121196023 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | oxan-2-ylmethyl N-[(1-pyridin-4-yltriazol-4-yl)methyl]carbamate |
| SMILES | O=C(NCc1cn(-c2ccncc2)nn1)OCC1CCCCO1 |
| InChI | InChI=1S/C15H19N5O3/c21-15(23-11-14-3-1-2-8-22-14)17-9-12-10-20(19-18-12)13-4-6-16-7-5-13/h4-7,10,14H,1-3,8-9,11H2,(H,17,21) |
| InChIKey | CTCRHROBACVPSM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |