C13H14N4O — CID 121205140
2-(azidomethyl)-5-(2,4,5-trimethylphenyl)-1,3-oxazole (PubChem CID 121205140) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(azidomethyl)-5-(2,4,5-trimethylphenyl)-1,3-oxazole.
| Compound Name | 2-(azidomethyl)-5-(2,4,5-trimethylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 121205140 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-(azidomethyl)-5-(2,4,5-trimethylphenyl)-1,3-oxazole |
| SMILES | Cc1cc(C)c(-c2cnc(CN=[N+]=[N-])o2)cc1C |
| InChI | InChI=1S/C13H14N4O/c1-8-4-10(3)11(5-9(8)2)12-6-15-13(18-12)7-16-17-14/h4-6H,7H2,1-3H3 |
| InChIKey | SWTCAJZMKKLWCQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|