C5H4N4O3 — CID 118453597
2-(azidomethyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 118453597) has the molecular formula C5H4N4O3 and a molecular weight of 168.11 g/mol. Its IUPAC name is 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 118453597 |
| Molecular Formula | C5H4N4O3 |
| Molecular Weight | 168.11 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | [N-]=[N+]=NCc1ncc(C(=O)O)o1 |
| InChI | InChI=1S/C5H4N4O3/c6-9-8-2-4-7-1-3(12-4)5(10)11/h1H,2H2,(H,10,11) |
| InChIKey | BDCODFKMRASABA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.11 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|