2-(azidomethyl)-1,3-oxazole-5-carboxylic acid

C5H4N4O3 — CID 118453597

IUPAC2-(azidomethyl)-1,3-oxazole-5-carboxylic acid
SMILES[N-]=[N+]=NCc1ncc(C(=O)O)o1
InChIInChI=1S/C5H4N4O3/c6-9-8-2-4-7-1-3(12-4)5(10)11/h1H,2H2,(H,10,11)
InChIKeyBDCODFKMRASABA-UHFFFAOYSA-N
MW168.11 g/mol
LogP1.18
Rot. Bonds3

About 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid

2-(azidomethyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 118453597) has the molecular formula C5H4N4O3 and a molecular weight of 168.11 g/mol. Its IUPAC name is 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(azidomethyl)-1,3-oxazole-5-carboxylic acid
PubChem CID118453597
Molecular FormulaC5H4N4O3
Molecular Weight168.11 g/mol
Exact Mass168.03
IUPAC Name2-(azidomethyl)-1,3-oxazole-5-carboxylic acid
SMILES[N-]=[N+]=NCc1ncc(C(=O)O)o1
InChIInChI=1S/C5H4N4O3/c6-9-8-2-4-7-1-3(12-4)5(10)11/h1H,2H2,(H,10,11)
InChIKeyBDCODFKMRASABA-UHFFFAOYSA-N
XLogP1.18
TPSA112.09 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.11
LogP ≤ 51.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid (CID 118453597) is 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid is [N-]=[N+]=NCc1ncc(C(=O)O)o1.
What is the InChIKey of 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is BDCODFKMRASABA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O3/c6-9-8-2-4-7-1-3(12-4)5(10)11/h1H,2H2,(H,10,11).
What are the key properties of 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid?
2-(azidomethyl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 168.11 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azidomethyl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 118453597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).