C9H5Cl2N3O2 — CID 91250095
5-(azidomethyl)benzene-1,3-dicarbonyl chloride (PubChem CID 91250095) has the molecular formula C9H5Cl2N3O2 and a molecular weight of 258.06 g/mol. Its IUPAC name is 5-(azidomethyl)benzene-1,3-dicarbonyl chloride.
| Compound Name | 5-(azidomethyl)benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 91250095 |
| Molecular Formula | C9H5Cl2N3O2 |
| Molecular Weight | 258.06 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 5-(azidomethyl)benzene-1,3-dicarbonyl chloride |
| SMILES | [N-]=[N+]=NCc1cc(C(=O)Cl)cc(C(=O)Cl)c1 |
| InChI | InChI=1S/C9H5Cl2N3O2/c10-8(15)6-1-5(4-13-14-12)2-7(3-6)9(11)16/h1-3H,4H2 |
| InChIKey | WTHWCUYPYOBZHN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.06 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|