C9H5Cl4N3 — CID 14407250
1-(azidomethyl)-3-chloro-5-(1,2,2-trichloroethenyl)benzene (PubChem CID 14407250) has the molecular formula C9H5Cl4N3 and a molecular weight of 296.97 g/mol. Its IUPAC name is 1-(azidomethyl)-3-chloro-5-(1,2,2-trichloroethenyl)benzene.
| Compound Name | 1-(azidomethyl)-3-chloro-5-(1,2,2-trichloroethenyl)benzene |
|---|---|
| PubChem CID | 14407250 |
| Molecular Formula | C9H5Cl4N3 |
| Molecular Weight | 296.97 g/mol |
| Exact Mass | 294.92 |
| IUPAC Name | 1-(azidomethyl)-3-chloro-5-(1,2,2-trichloroethenyl)benzene |
| SMILES | [N-]=[N+]=NCc1cc(Cl)cc(C(Cl)=C(Cl)Cl)c1 |
| InChI | InChI=1S/C9H5Cl4N3/c10-7-2-5(4-15-16-14)1-6(3-7)8(11)9(12)13/h1-3H,4H2 |
| InChIKey | KRHNDVPKPZDIEF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.97 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|