About 3-(azidomethyl)benzamide
3-(azidomethyl)benzamide (PubChem CID 61374948) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is 3-(azidomethyl)benzamide.
Molecular Properties
| Compound Name | 3-(azidomethyl)benzamide |
| PubChem CID | 61374948 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-(azidomethyl)benzamide |
| SMILES | [N-]=[N+]=NCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C8H8N4O/c9-8(13)7-3-1-2-6(4-7)5-11-12-10/h1-4H,5H2,(H2,9,13) |
| InChIKey | HFTJXIZORPSUPW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(azidomethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azidomethyl)benzamide?
The IUPAC name of 3-(azidomethyl)benzamide (CID 61374948) is 3-(azidomethyl)benzamide.
What is the SMILES notation for 3-(azidomethyl)benzamide?
The canonical SMILES for 3-(azidomethyl)benzamide is [N-]=[N+]=NCc1cccc(C(N)=O)c1.
What is the InChIKey of 3-(azidomethyl)benzamide?
The InChIKey is HFTJXIZORPSUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O/c9-8(13)7-3-1-2-6(4-7)5-11-12-10/h1-4H,5H2,(H2,9,13).
What are the key properties of 3-(azidomethyl)benzamide?
3-(azidomethyl)benzamide has a molecular weight of 176.18 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azidomethyl)benzamide is sourced from PubChem (CID 61374948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).