About 3-(azidomethyl)-N'-hexanoylbenzohydrazide
3-(azidomethyl)-N'-hexanoylbenzohydrazide (PubChem CID 150083368) has the molecular formula C14H19N5O2
and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-(azidomethyl)-N'-hexanoylbenzohydrazide.
Molecular Properties
| Compound Name | 3-(azidomethyl)-N'-hexanoylbenzohydrazide |
| PubChem CID | 150083368 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-(azidomethyl)-N'-hexanoylbenzohydrazide |
| SMILES | CCCCCC(=O)NNC(=O)c1cccc(CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C14H19N5O2/c1-2-3-4-8-13(20)17-18-14(21)12-7-5-6-11(9-12)10-16-19-15/h5-7,9H,2-4,8,10H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | DRSMCUWGSSKZLN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(azidomethyl)-N'-hexanoylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azidomethyl)-N'-hexanoylbenzohydrazide?
The IUPAC name of 3-(azidomethyl)-N'-hexanoylbenzohydrazide (CID 150083368) is 3-(azidomethyl)-N'-hexanoylbenzohydrazide.
What is the SMILES notation for 3-(azidomethyl)-N'-hexanoylbenzohydrazide?
The canonical SMILES for 3-(azidomethyl)-N'-hexanoylbenzohydrazide is CCCCCC(=O)NNC(=O)c1cccc(CN=[N+]=[N-])c1.
What is the InChIKey of 3-(azidomethyl)-N'-hexanoylbenzohydrazide?
The InChIKey is DRSMCUWGSSKZLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2/c1-2-3-4-8-13(20)17-18-14(21)12-7-5-6-11(9-12)10-16-19-15/h5-7,9H,2-4,8,10H2,1H3,(H,17,20)(H,18,21).
What are the key properties of 3-(azidomethyl)-N'-hexanoylbenzohydrazide?
3-(azidomethyl)-N'-hexanoylbenzohydrazide has a molecular weight of 289.34 g/mol, XLogP of 2.84, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azidomethyl)-N'-hexanoylbenzohydrazide is sourced from PubChem (CID 150083368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).