C14H9Cl6N3O — CID 158687565
5-(azidomethyl)-1,2,3-trichlorobenzene;(3,4,5-trichlorophenyl)methanol (PubChem CID 158687565) has the molecular formula C14H9Cl6N3O and a molecular weight of 447.96 g/mol. Its IUPAC name is 5-(azidomethyl)-1,2,3-trichlorobenzene;(3,4,5-trichlorophenyl)methanol.
| Compound Name | 5-(azidomethyl)-1,2,3-trichlorobenzene;(3,4,5-trichlorophenyl)methanol |
|---|---|
| PubChem CID | 158687565 |
| Molecular Formula | C14H9Cl6N3O |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 444.89 |
| IUPAC Name | 5-(azidomethyl)-1,2,3-trichlorobenzene;(3,4,5-trichlorophenyl)methanol |
| SMILES | OCc1cc(Cl)c(Cl)c(Cl)c1.[N-]=[N+]=NCc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C7H4Cl3N3.C7H5Cl3O/c8-5-1-4(3-12-13-11)2-6(9)7(5)10;8-5-1-4(3-11)2-6(9)7(5)10/h1-2H,3H2;1-2,11H,3H2 |
| InChIKey | IFXWOYAGMWOKIO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|