C13H14FN7O — CID 167904923
3-azido-5-(azidomethyl)-N-[3-(fluoromethyl)cyclobutyl]benzamide (PubChem CID 167904923) has the molecular formula C13H14FN7O and a molecular weight of 303.30 g/mol. Its IUPAC name is 3-azido-5-(azidomethyl)-N-[3-(fluoromethyl)cyclobutyl]benzamide.
| Compound Name | 3-azido-5-(azidomethyl)-N-[3-(fluoromethyl)cyclobutyl]benzamide |
|---|---|
| PubChem CID | 167904923 |
| Molecular Formula | C13H14FN7O |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-azido-5-(azidomethyl)-N-[3-(fluoromethyl)cyclobutyl]benzamide |
| SMILES | [N-]=[N+]=NCc1cc(N=[N+]=[N-])cc(C(=O)NC2CC(CF)C2)c1 |
| InChI | InChI=1S/C13H14FN7O/c14-6-8-2-11(3-8)18-13(22)10-1-9(7-17-20-15)4-12(5-10)19-21-16/h1,4-5,8,11H,2-3,6-7H2,(H,18,22) |
| InChIKey | URRWMZSHOYBLNQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|