C14H19N7O2 — CID 167868390
3-azido-5-(azidomethyl)-N-(1-ethoxy-2-methylpropan-2-yl)benzamide (PubChem CID 167868390) has the molecular formula C14H19N7O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 3-azido-5-(azidomethyl)-N-(1-ethoxy-2-methylpropan-2-yl)benzamide.
| Compound Name | 3-azido-5-(azidomethyl)-N-(1-ethoxy-2-methylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 167868390 |
| Molecular Formula | C14H19N7O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-azido-5-(azidomethyl)-N-(1-ethoxy-2-methylpropan-2-yl)benzamide |
| SMILES | CCOCC(C)(C)NC(=O)c1cc(CN=[N+]=[N-])cc(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C14H19N7O2/c1-4-23-9-14(2,3)18-13(22)11-5-10(8-17-20-15)6-12(7-11)19-21-16/h5-7H,4,8-9H2,1-3H3,(H,18,22) |
| InChIKey | MQNNAKDMJKZPQM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|