About 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one
5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one (PubChem CID 51003128) has the molecular formula C17H14N6O4
and a molecular weight of 366.34 g/mol. Its IUPAC name is 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one.
Molecular Properties
| Compound Name | 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one |
| PubChem CID | 51003128 |
| Molecular Formula | C17H14N6O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one |
| SMILES | Cc1c2cc(COCc3cc(CN=[N+]=[N-])cc(N=[N+]=[N-])c3)occ-2oc1=O |
| InChI | InChI=1S/C17H14N6O4/c1-10-15-5-14(26-9-16(15)27-17(10)24)8-25-7-12-2-11(6-20-22-18)3-13(4-12)21-23-19/h2-5,9H,6-8H2,1H3 |
| InChIKey | SBBAIYABKQOWAV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 150.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one?
The IUPAC name of 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one (CID 51003128) is 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one.
What is the SMILES notation for 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one?
The canonical SMILES for 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one is Cc1c2cc(COCc3cc(CN=[N+]=[N-])cc(N=[N+]=[N-])c3)occ-2oc1=O.
What is the InChIKey of 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one?
The InChIKey is SBBAIYABKQOWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N6O4/c1-10-15-5-14(26-9-16(15)27-17(10)24)8-25-7-12-2-11(6-20-22-18)3-13(4-12)21-23-19/h2-5,9H,6-8H2,1H3.
What are the key properties of 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one?
5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one has a molecular weight of 366.34 g/mol, XLogP of 5.11, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-azido-5-(azidomethyl)phenyl]methoxymethyl]-3-methylfuro[2,3-c]pyran-2-one is sourced from PubChem (CID 51003128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).