C14H13N9O2 — CID 167893762
(3-amino-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl)-[3-azido-5-(azidomethyl)phenyl]methanone (PubChem CID 167893762) has the molecular formula C14H13N9O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is (3-amino-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl)-[3-azido-5-(azidomethyl)phenyl]methanone.
| Compound Name | (3-amino-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl)-[3-azido-5-(azidomethyl)phenyl]methanone |
|---|---|
| PubChem CID | 167893762 |
| Molecular Formula | C14H13N9O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (3-amino-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl)-[3-azido-5-(azidomethyl)phenyl]methanone |
| SMILES | [N-]=[N+]=NCc1cc(N=[N+]=[N-])cc(C(=O)N2CCc3noc(N)c3C2)c1 |
| InChI | InChI=1S/C14H13N9O2/c15-13-11-7-23(2-1-12(11)20-25-13)14(24)9-3-8(6-18-21-16)4-10(5-9)19-22-17/h3-5H,1-2,6-7,15H2 |
| InChIKey | IOUNTNKPOOBMGT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|