C19H16ClN3O5 — CID 136500428
(3-amino-4-hydroxyphenyl)-[3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]methanone (PubChem CID 136500428) has the molecular formula C19H16ClN3O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is (3-amino-4-hydroxyphenyl)-[3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]methanone.
| Compound Name | (3-amino-4-hydroxyphenyl)-[3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 136500428 |
| Molecular Formula | C19H16ClN3O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | (3-amino-4-hydroxyphenyl)-[3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]methanone |
| SMILES | Nc1cc(C(=O)N2CCc3noc(-c4cc(Cl)c(O)cc4O)c3C2)ccc1O |
| InChI | InChI=1S/C19H16ClN3O5/c20-12-6-10(16(25)7-17(12)26)18-11-8-23(4-3-14(11)22-28-18)19(27)9-1-2-15(24)13(21)5-9/h1-2,5-7,24-26H,3-4,8,21H2 |
| InChIKey | RZXPDWGZILLJIC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 133.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|