C20H15ClF3N3O5 — CID 136500645
[3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone (PubChem CID 136500645) has the molecular formula C20H15ClF3N3O5 and a molecular weight of 469.80 g/mol. Its IUPAC name is [3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone.
| Compound Name | [3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 136500645 |
| Molecular Formula | C20H15ClF3N3O5 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | [3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(OCC(F)(F)F)nc1)N1CCc2noc(-c3cc(Cl)c(O)cc3O)c2C1 |
| InChI | InChI=1S/C20H15ClF3N3O5/c21-13-5-11(15(28)6-16(13)29)18-12-8-27(4-3-14(12)26-32-18)19(30)10-1-2-17(25-7-10)31-9-20(22,23)24/h1-2,5-7,28-29H,3-4,8-9H2 |
| InChIKey | APCBNTDKPKDUFP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |