C23H22ClN3O6S — CID 136500480
[3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanone (PubChem CID 136500480) has the molecular formula C23H22ClN3O6S and a molecular weight of 503.96 g/mol. Its IUPAC name is [3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanone.
| Compound Name | [3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 136500480 |
| Molecular Formula | C23H22ClN3O6S |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | [3-(5-chloro-2,4-dihydroxyphenyl)-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl]-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(N2CCS(=O)(=O)CC2)cc1)N1CCc2noc(-c3cc(Cl)c(O)cc3O)c2C1 |
| InChI | InChI=1S/C23H22ClN3O6S/c24-18-11-16(20(28)12-21(18)29)22-17-13-27(6-5-19(17)25-33-22)23(30)14-1-3-15(4-2-14)26-7-9-34(31,32)10-8-26/h1-4,11-12,28-29H,5-10,13H2 |
| InChIKey | AHIJUWKBELNUAQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 124.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |