C23H25ClN4O5S — CID 136500679
[3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]methanone (PubChem CID 136500679) has the molecular formula C23H25ClN4O5S and a molecular weight of 505.00 g/mol. Its IUPAC name is [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]methanone.
| Compound Name | [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 136500679 |
| Molecular Formula | C23H25ClN4O5S |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[4-(1,1-dihydroxy-1,4-thiazinan-4-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(N2CCS(O)(O)CC2)cc1)N1CCc2[nH]nc(-c3cc(Cl)c(O)cc3O)c2C1 |
| InChI | InChI=1S/C23H25ClN4O5S/c24-18-11-16(20(29)12-21(18)30)22-17-13-28(6-5-19(17)25-26-22)23(31)14-1-3-15(4-2-14)27-7-9-34(32,33)10-8-27/h1-4,11-12,29-30,32-33H,5-10,13H2,(H,25,26) |
| InChIKey | WGRDRARPBRLLDT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 133.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |