C17H15ClN4O4S2 — CID 136500525
3-[2-[3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 136500525) has the molecular formula C17H15ClN4O4S2 and a molecular weight of 438.92 g/mol. Its IUPAC name is 3-[2-[3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-[3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136500525 |
| Molecular Formula | C17H15ClN4O4S2 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 3-[2-[3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-oxoethyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C(CN1C(=O)CSC1=S)N1CCc2[nH]nc(-c3cc(Cl)c(O)cc3O)c2C1 |
| InChI | InChI=1S/C17H15ClN4O4S2/c18-10-3-8(12(23)4-13(10)24)16-9-5-21(2-1-11(9)19-20-16)14(25)6-22-15(26)7-28-17(22)27/h3-4,23-24H,1-2,5-7H2,(H,19,20) |
| InChIKey | WTOQAZYZTIHXSL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|