C20H24ClN3O4 — CID 136500482
[3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(1S,3R)-3-methoxycyclohexyl]methanone (PubChem CID 136500482) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(1S,3R)-3-methoxycyclohexyl]methanone.
| Compound Name | [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(1S,3R)-3-methoxycyclohexyl]methanone |
|---|---|
| PubChem CID | 136500482 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(1S,3R)-3-methoxycyclohexyl]methanone |
| SMILES | CO[C@@H]1CCC[C@H](C(=O)N2CCc3[nH]nc(-c4cc(Cl)c(O)cc4O)c3C2)C1 |
| InChI | InChI=1S/C20H24ClN3O4/c1-28-12-4-2-3-11(7-12)20(27)24-6-5-16-14(10-24)19(23-22-16)13-8-15(21)18(26)9-17(13)25/h8-9,11-12,25-26H,2-7,10H2,1H3,(H,22,23)/t11-,12+/m0/s1 |
| InChIKey | XWYRDRPYLVTCGA-NWDGAFQWSA-N |
| XLogP | 3.23 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |