C17H19ClN4O3 — CID 136500445
[3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(2S)-pyrrolidin-2-yl]methanone (PubChem CID 136500445) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(2S)-pyrrolidin-2-yl]methanone.
| Compound Name | [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(2S)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 136500445 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | [3-(5-chloro-2,4-dihydroxyphenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-[(2S)-pyrrolidin-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCN1)N1CCc2[nH]nc(-c3cc(Cl)c(O)cc3O)c2C1 |
| InChI | InChI=1S/C17H19ClN4O3/c18-11-6-9(14(23)7-15(11)24)16-10-8-22(5-3-12(10)20-21-16)17(25)13-2-1-4-19-13/h6-7,13,19,23-24H,1-5,8H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | KYOXNDAKGNSFQO-ZDUSSCGKSA-N |
| XLogP | 1.78 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |